C12H19Cl2N3OS — CID 119894757
(1-aminocyclopropyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119894757) has the molecular formula C12H19Cl2N3OS and a molecular weight of 324.28 g/mol. Its IUPAC name is (1-aminocyclopropyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (1-aminocyclopropyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119894757 |
| Molecular Formula | C12H19Cl2N3OS |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (1-aminocyclopropyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1(C(=O)N2CCN(c3cccs3)CC2)CC1 |
| InChI | InChI=1S/C12H17N3OS.2ClH/c13-12(3-4-12)11(16)15-7-5-14(6-8-15)10-2-1-9-17-10;;/h1-2,9H,3-8,13H2;2*1H |
| InChIKey | SSGCRDOPIRAKDR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |