C14H20N2O3S2 — CID 136538916
(1-methylsulfonylcyclobutyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone (PubChem CID 136538916) has the molecular formula C14H20N2O3S2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (1-methylsulfonylcyclobutyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone.
| Compound Name | (1-methylsulfonylcyclobutyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 136538916 |
| Molecular Formula | C14H20N2O3S2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (1-methylsulfonylcyclobutyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)C1(C(=O)N2CCN(c3cccs3)CC2)CCC1 |
| InChI | InChI=1S/C14H20N2O3S2/c1-21(18,19)14(5-3-6-14)13(17)16-9-7-15(8-10-16)12-4-2-11-20-12/h2,4,11H,3,5-10H2,1H3 |
| InChIKey | XLYMOSDNPHGAHE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |