C13H21NS — CID 138708345
2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidine (PubChem CID 138708345) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidine |
|---|---|
| PubChem CID | 138708345 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1c1cccs1 |
| InChI | InChI=1S/C13H21NS/c1-12(2)8-6-9-13(3,4)14(12)11-7-5-10-15-11/h5,7,10H,6,8-9H2,1-4H3 |
| InChIKey | VGPYTHGJBSITQM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |