C23H37NO4S — CID 150779656
10-oxo-10-(2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidin-4-yl)oxydecanoic acid (PubChem CID 150779656) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is 10-oxo-10-(2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidin-4-yl)oxydecanoic acid.
| Compound Name | 10-oxo-10-(2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidin-4-yl)oxydecanoic acid |
|---|---|
| PubChem CID | 150779656 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 10-oxo-10-(2,2,6,6-tetramethyl-1-thiophen-2-ylpiperidin-4-yl)oxydecanoic acid |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)O)CC(C)(C)N1c1cccs1 |
| InChI | InChI=1S/C23H37NO4S/c1-22(2)16-18(17-23(3,4)24(22)19-12-11-15-29-19)28-21(27)14-10-8-6-5-7-9-13-20(25)26/h11-12,15,18H,5-10,13-14,16-17H2,1-4H3,(H,25,26) |
| InChIKey | KBPIFHJILLWDMH-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|