C28H48N2O6 — CID 15019922
bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) hexanedioate (PubChem CID 15019922) has the molecular formula C28H48N2O6 and a molecular weight of 508.70 g/mol. Its IUPAC name is bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) hexanedioate.
| Compound Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) hexanedioate |
|---|---|
| PubChem CID | 15019922 |
| Molecular Formula | C28H48N2O6 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.35 |
| IUPAC Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) hexanedioate |
| SMILES | CC(=O)N1C(C)(C)CC(OC(=O)CCCCC(=O)OC2CC(C)(C)N(C(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C28H48N2O6/c1-19(31)29-25(3,4)15-21(16-26(29,5)6)35-23(33)13-11-12-14-24(34)36-22-17-27(7,8)30(20(2)32)28(9,10)18-22/h21-22H,11-18H2,1-10H3 |
| InChIKey | HZVWDZVPGODNEB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|