C42H80N2O4 — CID 54027959
bis(2,6-ditert-butyl-1,2,6-trimethylpiperidin-4-yl) decanedioate (PubChem CID 54027959) has the molecular formula C42H80N2O4 and a molecular weight of 677.11 g/mol. Its IUPAC name is bis(2,6-ditert-butyl-1,2,6-trimethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(2,6-ditert-butyl-1,2,6-trimethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 54027959 |
| Molecular Formula | C42H80N2O4 |
| Molecular Weight | 677.11 g/mol |
| Exact Mass | 676.61 |
| IUPAC Name | bis(2,6-ditert-butyl-1,2,6-trimethylpiperidin-4-yl) decanedioate |
| SMILES | CN1C(C)(C(C)(C)C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C(C)(C)C)N(C)C(C)(C(C)(C)C)C2)CC1(C)C(C)(C)C |
| InChI | InChI=1S/C42H80N2O4/c1-35(2,3)39(13)27-31(28-40(14,43(39)17)36(4,5)6)47-33(45)25-23-21-19-20-22-24-26-34(46)48-32-29-41(15,37(7,8)9)44(18)42(16,30-32)38(10,11)12/h31-32H,19-30H2,1-18H3 |
| InChIKey | LDOMTBUSMFOUNZ-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.11 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|