C32H60N2O4 — CID 141285450
bis(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 141285450) has the molecular formula C32H60N2O4 and a molecular weight of 536.84 g/mol. Its IUPAC name is bis(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | bis(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 141285450 |
| Molecular Formula | C32H60N2O4 |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 536.46 |
| IUPAC Name | bis(1-ethyl-2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CCN1C(C)(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(CC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C32H60N2O4/c1-11-33-29(3,4)21-25(22-30(33,5)6)37-27(35)19-17-15-13-14-16-18-20-28(36)38-26-23-31(7,8)34(12-2)32(9,10)24-26/h25-26H,11-24H2,1-10H3 |
| InChIKey | ICRMDVIZMNTZLN-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|