C28H51N3O6 — CID 126595053
10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-nitrosopiperidin-4-yl) decanedioate (PubChem CID 126595053) has the molecular formula C28H51N3O6 and a molecular weight of 525.73 g/mol. Its IUPAC name is 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-nitrosopiperidin-4-yl) decanedioate.
| Compound Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-nitrosopiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 126595053 |
| Molecular Formula | C28H51N3O6 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | 10-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-nitrosopiperidin-4-yl) decanedioate |
| SMILES | CC1(C)CC(OC(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(N=O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C28H51N3O6/c1-25(2)17-21(18-26(3,4)30(25)29-34)36-23(32)15-13-11-9-10-12-14-16-24(33)37-22-19-27(5,6)31(35)28(7,8)20-22/h21-22,35H,9-20H2,1-8H3 |
| InChIKey | VXAIHTQMCGNWAP-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|