About CID 163897678
CID 163897678 (PubChem CID 163897678) has the molecular formula C22H39INO5-
and a molecular weight of 524.46 g/mol.
Molecular Properties
| Compound Name | CID 163897678 |
| PubChem CID | 163897678 |
| Molecular Formula | C22H39INO5- |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)CCC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)[I-]1 |
| InChI | InChI=1S/C22H39INO5/c1-19(2)11-15(12-20(3,4)23-19)28-17(25)9-10-18(26)29-16-13-21(5,6)24(27)22(7,8)14-16/h15-16,27H,9-14H2,1-8H3/q-1 |
| InChIKey | URCNKFYOZRZFTK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze CID 163897678 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163897678?
The IUPAC name of CID 163897678 (CID 163897678) is not available.
What is the SMILES notation for CID 163897678?
The canonical SMILES for CID 163897678 is CC1(C)CC(OC(=O)CCC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)[I-]1.
What is the InChIKey of CID 163897678?
The InChIKey is URCNKFYOZRZFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39INO5/c1-19(2)11-15(12-20(3,4)23-19)28-17(25)9-10-18(26)29-16-13-21(5,6)24(27)22(7,8)14-16/h15-16,27H,9-14H2,1-8H3/q-1.
What are the key properties of CID 163897678?
CID 163897678 has a molecular weight of 524.46 g/mol, XLogP of 1.07, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163897678 is sourced from PubChem (CID 163897678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).