C14H25NO4 — CID 155198262
(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-methyl-4-oxobutanoate (PubChem CID 155198262) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-methyl-4-oxobutanoate.
| Compound Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 155198262 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | (1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 3-methyl-4-oxobutanoate |
| SMILES | CC(C=O)CC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H25NO4/c1-10(9-16)6-12(17)19-11-7-13(2,3)15(18)14(4,5)8-11/h9-11,18H,6-8H2,1-5H3 |
| InChIKey | ZFSCTBNWJRAUCT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|