C31H55N3O7 — CID 71191761
bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)butanedioate (PubChem CID 71191761) has the molecular formula C31H55N3O7 and a molecular weight of 581.80 g/mol. Its IUPAC name is bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)butanedioate.
| Compound Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)butanedioate |
|---|---|
| PubChem CID | 71191761 |
| Molecular Formula | C31H55N3O7 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 2-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-ylidene)butanedioate |
| SMILES | CC1(C)CC(=C(CC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C31H55N3O7/c1-26(2)14-20(15-27(3,4)32(26)37)23(25(36)41-22-18-30(9,10)34(39)31(11,12)19-22)13-24(35)40-21-16-28(5,6)33(38)29(7,8)17-21/h21-22,37-39H,13-19H2,1-12H3 |
| InChIKey | IXZDFKJZEREAFT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|