C23H42N2O6 — CID 20576509
bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate (PubChem CID 20576509) has the molecular formula C23H42N2O6 and a molecular weight of 442.60 g/mol. Its IUPAC name is bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate.
| Compound Name | bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 20576509 |
| Molecular Formula | C23H42N2O6 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.30 |
| IUPAC Name | bis(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) propanedioate |
| SMILES | CON1C(C)(C)CC(OC(=O)CC(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C23H42N2O6/c1-20(2)12-16(13-21(3,4)24(20)28-9)30-18(26)11-19(27)31-17-14-22(5,6)25(29-10)23(7,8)15-17/h16-17H,11-15H2,1-10H3 |
| InChIKey | GHVWDIVFWJGSDO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|