C23H41N2O6- — CID 158347381
1-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) pentanedioate (PubChem CID 158347381) has the molecular formula C23H41N2O6- and a molecular weight of 441.59 g/mol. Its IUPAC name is 1-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) pentanedioate.
| Compound Name | 1-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) pentanedioate |
|---|---|
| PubChem CID | 158347381 |
| Molecular Formula | C23H41N2O6- |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | 1-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) pentanedioate |
| SMILES | CC1(C)CC(OC(=O)CCCC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C23H41N2O6/c1-20(2)12-16(13-21(3,4)24(20)28)30-18(26)10-9-11-19(27)31-17-14-22(5,6)25(29)23(7,8)15-17/h16-17,28H,9-15H2,1-8H3/q-1 |
| InChIKey | GRWZKIAWRCLRFF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |