C32H56N3O9- — CID 147915843
1-O,2-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) ethane-1,1,2-tricarboxylate (PubChem CID 147915843) has the molecular formula C32H56N3O9- and a molecular weight of 626.81 g/mol. Its IUPAC name is 1-O,2-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) ethane-1,1,2-tricarboxylate.
| Compound Name | 1-O,2-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 147915843 |
| Molecular Formula | C32H56N3O9- |
| Molecular Weight | 626.81 g/mol |
| Exact Mass | 626.40 |
| IUPAC Name | 1-O,2-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl) ethane-1,1,2-tricarboxylate |
| SMILES | CC1(C)CC(OC(=O)C(CC(=O)OC2CC(C)(C)N(O)C(C)(C)C2)C(=O)OC2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C32H56N3O9/c1-27(2)14-20(15-28(3,4)33(27)39)42-24(36)13-23(25(37)43-21-16-29(5,6)34(40)30(7,8)17-21)26(38)44-22-18-31(9,10)35(41)32(11,12)19-22/h20-23,39-40H,13-19H2,1-12H3/q-1 |
| InChIKey | IHAVODXLNINAPB-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|