C45H79N3O9 — CID 90132227
1-O,2-O-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate (PubChem CID 90132227) has the molecular formula C45H79N3O9 and a molecular weight of 806.14 g/mol. Its IUPAC name is 1-O,2-O-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate.
| Compound Name | 1-O,2-O-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 90132227 |
| Molecular Formula | C45H79N3O9 |
| Molecular Weight | 806.14 g/mol |
| Exact Mass | 805.58 |
| IUPAC Name | 1-O,2-O-bis(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
| SMILES | CON1C(C)(C)CC(OC(=O)C(CC(=O)OC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)C(=O)OC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C45H79N3O9/c1-40(2)27-34(28-41(3,4)46(40)52-13)54-38(50)36(39(51)55-35-29-44(9,10)48(45(11,12)30-35)57-32-22-18-15-19-23-32)24-37(49)53-33-25-42(5,6)47(43(7,8)26-33)56-31-20-16-14-17-21-31/h31-36H,14-30H2,1-13H3 |
| InChIKey | CQBPHGGEWYKTGY-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 116.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.14 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|