C11H20ClNO3 — CID 54035365
(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) carbonochloridate (PubChem CID 54035365) has the molecular formula C11H20ClNO3 and a molecular weight of 249.74 g/mol. Its IUPAC name is (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) carbonochloridate.
| Compound Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) carbonochloridate |
|---|---|
| PubChem CID | 54035365 |
| Molecular Formula | C11H20ClNO3 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) carbonochloridate |
| SMILES | CON1C(C)(C)CC(OC(=O)Cl)CC1(C)C |
| InChI | InChI=1S/C11H20ClNO3/c1-10(2)6-8(16-9(12)14)7-11(3,4)13(10)15-5/h8H,6-7H2,1-5H3 |
| InChIKey | LINXSYMLKLXLBO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|