C22H42N4O6 — CID 54536773
(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) N-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]carbamate (PubChem CID 54536773) has the molecular formula C22H42N4O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) N-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]carbamate.
| Compound Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) N-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 54536773 |
| Molecular Formula | C22H42N4O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | (1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) N-[(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]carbamate |
| SMILES | CON1C(C)(C)CC(OC(=O)NNC(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C22H42N4O6/c1-19(2)11-15(12-20(3,4)25(19)29-9)31-17(27)23-24-18(28)32-16-13-21(5,6)26(30-10)22(7,8)14-16/h15-16H,11-14H2,1-10H3,(H,23,27)(H,24,28) |
| InChIKey | ZAIJHIMRCKQLCD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|