C10H20NO2- — CID 71297217
1-methoxy-2,2,6,6-tetramethylpiperidin-4-olate (PubChem CID 71297217) has the molecular formula C10H20NO2- and a molecular weight of 186.27 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethylpiperidin-4-olate.
| Compound Name | 1-methoxy-2,2,6,6-tetramethylpiperidin-4-olate |
|---|---|
| PubChem CID | 71297217 |
| Molecular Formula | C10H20NO2- |
| Molecular Weight | 186.27 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethylpiperidin-4-olate |
| SMILES | CON1C(C)(C)CC([O-])CC1(C)C |
| InChI | InChI=1S/C10H20NO2/c1-9(2)6-8(12)7-10(3,4)11(9)13-5/h8H,6-7H2,1-5H3/q-1 |
| InChIKey | DOTBMZZTMSIPIG-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |