C12H20NO2 — CID 59188306
2,2,6,6-Tetramethyl-4-(2-propynyloxy)piperidine 1-Oxyl (PubChem CID 59188306) has the molecular formula C12H20NO2 and a molecular weight of 210.30 g/mol.
| Compound Name | 2,2,6,6-Tetramethyl-4-(2-propynyloxy)piperidine 1-Oxyl |
|---|---|
| PubChem CID | 59188306 |
| Molecular Formula | C12H20NO2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | — |
| SMILES | C#CCOC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C12H20NO2/c1-6-7-15-10-8-11(2,3)13(14)12(4,5)9-10/h1,10H,7-9H2,2-5H3 |
| InChIKey | POEBHISKBXRUBH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|