C13H23NO4 — CID 708860
(1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl) acetate (PubChem CID 708860) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl) acetate.
| Compound Name | (1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl) acetate |
|---|---|
| PubChem CID | 708860 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (1-acetyloxy-2,2,6,6-tetramethylpiperidin-4-yl) acetate |
| SMILES | CC(=O)OC1CC(C)(C)N(OC(C)=O)C(C)(C)C1 |
| InChI | InChI=1S/C13H23NO4/c1-9(15)17-11-7-12(3,4)14(18-10(2)16)13(5,6)8-11/h11H,7-8H2,1-6H3 |
| InChIKey | HTRTWIACWHJYFA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |