C40H71N3O10 — CID 18716423
tris(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 6-oxoheptane-1,2,4-tricarboxylate (PubChem CID 18716423) has the molecular formula C40H71N3O10 and a molecular weight of 754.02 g/mol. Its IUPAC name is tris(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 6-oxoheptane-1,2,4-tricarboxylate.
| Compound Name | tris(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 6-oxoheptane-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 18716423 |
| Molecular Formula | C40H71N3O10 |
| Molecular Weight | 754.02 g/mol |
| Exact Mass | 753.51 |
| IUPAC Name | tris(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl) 6-oxoheptane-1,2,4-tricarboxylate |
| SMILES | CON1C(C)(C)CC(OC(=O)CC(CC(CC(C)=O)C(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)C(=O)OC2CC(C)(C)N(OC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C40H71N3O10/c1-26(44)17-27(33(46)52-30-22-37(6,7)42(49-15)38(8,9)23-30)18-28(34(47)53-31-24-39(10,11)43(50-16)40(12,13)25-31)19-32(45)51-29-20-35(2,3)41(48-14)36(4,5)21-29/h27-31H,17-25H2,1-16H3 |
| InChIKey | FTIIYTVDVZCNCT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 133.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.02 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|