C20H33NO6 — CID 141419090
3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonyl-5-prop-2-enoyloxyhexanoic acid (PubChem CID 141419090) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is 3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonyl-5-prop-2-enoyloxyhexanoic acid.
| Compound Name | 3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonyl-5-prop-2-enoyloxyhexanoic acid |
|---|---|
| PubChem CID | 141419090 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 3-(1,2,2,6,6-pentamethylpiperidin-4-yl)oxycarbonyl-5-prop-2-enoyloxyhexanoic acid |
| SMILES | C=CC(=O)OC(C)CC(CC(=O)O)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C20H33NO6/c1-8-17(24)26-13(2)9-14(10-16(22)23)18(25)27-15-11-19(3,4)21(7)20(5,6)12-15/h8,13-15H,1,9-12H2,2-7H3,(H,22,23) |
| InChIKey | ASZUZWIEXJUVQU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|