C29H50N2O7 — CID 144808993
1-O-methyl 2-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 5-oxopentane-1,2,3-tricarboxylate (PubChem CID 144808993) has the molecular formula C29H50N2O7 and a molecular weight of 538.73 g/mol. Its IUPAC name is 1-O-methyl 2-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 5-oxopentane-1,2,3-tricarboxylate.
| Compound Name | 1-O-methyl 2-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 5-oxopentane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 144808993 |
| Molecular Formula | C29H50N2O7 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.36 |
| IUPAC Name | 1-O-methyl 2-O,3-O-bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 5-oxopentane-1,2,3-tricarboxylate |
| SMILES | COC(=O)CC(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(CC=O)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C29H50N2O7/c1-26(2)15-19(16-27(3,4)30(26)9)37-24(34)21(12-13-32)22(14-23(33)36-11)25(35)38-20-17-28(5,6)31(10)29(7,8)18-20/h13,19-22H,12,14-18H2,1-11H3 |
| InChIKey | GWLDKEDFDFQCGL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|