C16H27NO4 — CID 54340280
1-O-ethyl 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) but-2-enedioate (PubChem CID 54340280) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-O-ethyl 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) but-2-enedioate |
|---|---|
| PubChem CID | 54340280 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-O-ethyl 4-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) but-2-enedioate |
| SMILES | CCOC(=O)C=CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C16H27NO4/c1-7-20-13(18)8-9-14(19)21-12-10-15(2,3)17(6)16(4,5)11-12/h8-9,12H,7,10-11H2,1-6H3 |
| InChIKey | TYLCUJNZWGBKOR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|