C20H26INO4 — CID 170393088
4-O-(4-iodophenyl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) (E)-but-2-enedioate (PubChem CID 170393088) has the molecular formula C20H26INO4 and a molecular weight of 471.34 g/mol. Its IUPAC name is 4-O-(4-iodophenyl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) (E)-but-2-enedioate.
| Compound Name | 4-O-(4-iodophenyl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 170393088 |
| Molecular Formula | C20H26INO4 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 4-O-(4-iodophenyl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) (E)-but-2-enedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)/C=C/C(=O)Oc2ccc(I)cc2)CC1(C)C |
| InChI | InChI=1S/C20H26INO4/c1-19(2)12-16(13-20(3,4)22(19)5)26-18(24)11-10-17(23)25-15-8-6-14(21)7-9-15/h6-11,16H,12-13H2,1-5H3/b11-10+ |
| InChIKey | MVMUGNJHDQDZTP-ZHACJKMWSA-N |
| XLogP | 3.95 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|