C37H59N3O8 — CID 122697085
1-O,3-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) benzene-1,3,5-tricarboxylate (PubChem CID 122697085) has the molecular formula C37H59N3O8 and a molecular weight of 673.89 g/mol. Its IUPAC name is 1-O,3-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) benzene-1,3,5-tricarboxylate.
| Compound Name | 1-O,3-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 122697085 |
| Molecular Formula | C37H59N3O8 |
| Molecular Weight | 673.89 g/mol |
| Exact Mass | 673.43 |
| IUPAC Name | 1-O,3-O-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 5-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) benzene-1,3,5-tricarboxylate |
| SMILES | CN1C(C)(C)CC(OC(=O)c2cc(C(=O)OC3CC(C)(C)N(O)C(C)(C)C3)cc(C(=O)OC3CC(C)(C)N(O)C(C)(C)C3)c2)CC1(C)C |
| InChI | InChI=1S/C37H59N3O8/c1-32(2)17-26(18-33(3,4)38(32)13)46-29(41)23-14-24(30(42)47-27-19-34(5,6)39(44)35(7,8)20-27)16-25(15-23)31(43)48-28-21-36(9,10)40(45)37(11,12)22-28/h14-16,26-28,44-45H,17-22H2,1-13H3 |
| InChIKey | DJDCJZCGCJKHCD-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.89 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|