C25H46N2O5 — CID 118137042
4-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethylbutanedioate (PubChem CID 118137042) has the molecular formula C25H46N2O5 and a molecular weight of 454.65 g/mol. Its IUPAC name is 4-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethylbutanedioate.
| Compound Name | 4-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethylbutanedioate |
|---|---|
| PubChem CID | 118137042 |
| Molecular Formula | C25H46N2O5 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 4-O-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl) 1-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-ethylbutanedioate |
| SMILES | CCC(CC(=O)OC1CC(C)(C)N(O)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C25H46N2O5/c1-11-17(21(29)32-19-13-22(2,3)26(10)23(4,5)14-19)12-20(28)31-18-15-24(6,7)27(30)25(8,9)16-18/h17-19,30H,11-16H2,1-10H3 |
| InChIKey | OMAJECNMIKZIRD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |