C26H42N2O6 — CID 154095957
bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) but-2-enedioate (PubChem CID 154095957) has the molecular formula C26H42N2O6 and a molecular weight of 478.63 g/mol. Its IUPAC name is bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) but-2-enedioate.
| Compound Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) but-2-enedioate |
|---|---|
| PubChem CID | 154095957 |
| Molecular Formula | C26H42N2O6 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | bis(1-acetyl-2,2,6,6-tetramethylpiperidin-4-yl) but-2-enedioate |
| SMILES | CC(=O)N1C(C)(C)CC(OC(=O)C=CC(=O)OC2CC(C)(C)N(C(C)=O)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C26H42N2O6/c1-17(29)27-23(3,4)13-19(14-24(27,5)6)33-21(31)11-12-22(32)34-20-15-25(7,8)28(18(2)30)26(9,10)16-20/h11-12,19-20H,13-16H2,1-10H3 |
| InChIKey | BTVGATFGZMPJSU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|