C18H22Cl2NO3 — CID 122209642
CID 122209642 (PubChem CID 122209642) has the molecular formula C18H22Cl2NO3 and a molecular weight of 371.28 g/mol.
| Compound Name | CID 122209642 |
|---|---|
| PubChem CID | 122209642 |
| Molecular Formula | C18H22Cl2NO3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)/C=C/c2ccc(Cl)c(Cl)c2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C18H22Cl2NO3/c1-17(2)10-13(11-18(3,4)21(17)23)24-16(22)8-6-12-5-7-14(19)15(20)9-12/h5-9,13H,10-11H2,1-4H3/b8-6+ |
| InChIKey | KRNUCUYRHPYTEZ-SOFGYWHQSA-N |
| XLogP | 4.92 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|