C17H31NO2 — CID 139832038
(1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) (E)-but-2-enoate (PubChem CID 139832038) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) (E)-but-2-enoate.
| Compound Name | (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) (E)-but-2-enoate |
|---|---|
| PubChem CID | 139832038 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (1-butyl-2,2,6,6-tetramethylpiperidin-4-yl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC1CC(C)(C)N(CCCC)C(C)(C)C1 |
| InChI | InChI=1S/C17H31NO2/c1-7-9-11-18-16(3,4)12-14(13-17(18,5)6)20-15(19)10-8-2/h8,10,14H,7,9,11-13H2,1-6H3/b10-8+ |
| InChIKey | PBOYALXJGWUORQ-CSKARUKUSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|