C15H27NO3 — CID 141336457
(2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) prop-2-enoate (PubChem CID 141336457) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) prop-2-enoate.
| Compound Name | (2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141336457 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (2,2,6,6-tetramethyl-1-propoxypiperidin-4-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1CC(C)(C)N(OCCC)C(C)(C)C1 |
| InChI | InChI=1S/C15H27NO3/c1-7-9-18-16-14(3,4)10-12(11-15(16,5)6)19-13(17)8-2/h8,12H,2,7,9-11H2,1,3-6H3 |
| InChIKey | BRTODNPSJGAEAW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|