C22H41NO3 — CID 141336453
(2,2,4,6,6-pentamethyl-1-nonoxypiperidin-3-yl) prop-2-enoate (PubChem CID 141336453) has the molecular formula C22H41NO3 and a molecular weight of 367.57 g/mol. Its IUPAC name is (2,2,4,6,6-pentamethyl-1-nonoxypiperidin-3-yl) prop-2-enoate.
| Compound Name | (2,2,4,6,6-pentamethyl-1-nonoxypiperidin-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141336453 |
| Molecular Formula | C22H41NO3 |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.31 |
| IUPAC Name | (2,2,4,6,6-pentamethyl-1-nonoxypiperidin-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C(C)CC(C)(C)N(OCCCCCCCCC)C1(C)C |
| InChI | InChI=1S/C22H41NO3/c1-8-10-11-12-13-14-15-16-25-23-21(4,5)17-18(3)20(22(23,6)7)26-19(24)9-2/h9,18,20H,2,8,10-17H2,1,3-7H3 |
| InChIKey | JBMDHCGEMCZDLE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|