C13H24N2O2 — CID 150731669
(1-amino-2,2,4,6,6-pentamethylpiperidin-3-yl) prop-2-enoate (PubChem CID 150731669) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (1-amino-2,2,4,6,6-pentamethylpiperidin-3-yl) prop-2-enoate.
| Compound Name | (1-amino-2,2,4,6,6-pentamethylpiperidin-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 150731669 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (1-amino-2,2,4,6,6-pentamethylpiperidin-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C(C)CC(C)(C)N(N)C1(C)C |
| InChI | InChI=1S/C13H24N2O2/c1-7-10(16)17-11-9(2)8-12(3,4)15(14)13(11,5)6/h7,9,11H,1,8,14H2,2-6H3 |
| InChIKey | JRYSCYAYGCCJCF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|