C13H23NO2 — CID 141152931
(1,2,2,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate (PubChem CID 141152931) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (1,2,2,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate.
| Compound Name | (1,2,2,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 141152931 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1,2,2,6-tetramethylpiperidin-4-yl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1CC(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H23NO2/c1-6-12(15)16-9-11-7-10(2)14(5)13(3,4)8-11/h6,10-11H,1,7-9H2,2-5H3 |
| InChIKey | SJTUQQFCPUZOPP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|