C20H32N2O7 — CID 145111837
[2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 145111837) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is [2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 145111837 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | [2-[(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)oxycarbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)OC1CC(C)(C)N(O)C(C)(C)C1 |
| InChI | InChI=1S/C20H32N2O7/c1-8-15(23)27-12-20(7,13-28-16(24)9-2)21-17(25)29-14-10-18(3,4)22(26)19(5,6)11-14/h8-9,14,26H,1-2,10-13H2,3-7H3,(H,21,25) |
| InChIKey | SDCRZFOWPIRYRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|