C33H61N3O7 — CID 131974115
[2-methyl-3-prop-2-enoyloxy-2-[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxycarbonylamino]propyl] 3-[butyl(methyl)amino]propanoate (PubChem CID 131974115) has the molecular formula C33H61N3O7 and a molecular weight of 611.87 g/mol. Its IUPAC name is [2-methyl-3-prop-2-enoyloxy-2-[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxycarbonylamino]propyl] 3-[butyl(methyl)amino]propanoate.
| Compound Name | [2-methyl-3-prop-2-enoyloxy-2-[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxycarbonylamino]propyl] 3-[butyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 131974115 |
| Molecular Formula | C33H61N3O7 |
| Molecular Weight | 611.87 g/mol |
| Exact Mass | 611.45 |
| IUPAC Name | [2-methyl-3-prop-2-enoyloxy-2-[(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)oxycarbonylamino]propyl] 3-[butyl(methyl)amino]propanoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)CCN(C)CCCC)NC(=O)OC1CC(C)(C)N(OCCCCCCCC)C(C)(C)C1 |
| InChI | InChI=1S/C33H61N3O7/c1-10-13-15-16-17-18-22-42-36-31(4,5)23-27(24-32(36,6)7)43-30(39)34-33(8,25-40-28(37)12-3)26-41-29(38)19-21-35(9)20-14-11-2/h12,27H,3,10-11,13-26H2,1-2,4-9H3,(H,34,39) |
| InChIKey | ZBWVBCDQSWLQHJ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.87 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|