C21H42N2O3 — CID 139642514
4-hydroxy-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butanamide (PubChem CID 139642514) has the molecular formula C21H42N2O3 and a molecular weight of 370.58 g/mol. Its IUPAC name is 4-hydroxy-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butanamide.
| Compound Name | 4-hydroxy-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 139642514 |
| Molecular Formula | C21H42N2O3 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 4-hydroxy-N-(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)butanamide |
| SMILES | CCCCCCCCON1C(C)(C)CC(NC(=O)CCCO)CC1(C)C |
| InChI | InChI=1S/C21H42N2O3/c1-6-7-8-9-10-11-15-26-23-20(2,3)16-18(17-21(23,4)5)22-19(25)13-12-14-24/h18,24H,6-17H2,1-5H3,(H,22,25) |
| InChIKey | HXOFMFRKIXAJCR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|