C44H86N2O4 — CID 157140421
2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)decanoic acid (PubChem CID 157140421) has the molecular formula C44H86N2O4 and a molecular weight of 707.18 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)decanoic acid.
| Compound Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)decanoic acid |
|---|---|
| PubChem CID | 157140421 |
| Molecular Formula | C44H86N2O4 |
| Molecular Weight | 707.18 g/mol |
| Exact Mass | 706.66 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl)decanoic acid |
| SMILES | CCCCCCCCON1C(C)(C)CC(C(CCCCCCCC)(C(=O)O)C2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C44H86N2O4/c1-12-15-18-21-24-27-30-44(39(47)48,37-33-40(4,5)45(41(6,7)34-37)49-31-28-25-22-19-16-13-2)38-35-42(8,9)46(43(10,11)36-38)50-32-29-26-23-20-17-14-3/h37-38H,12-36H2,1-11H3,(H,47,48) |
| InChIKey | AKCXLRMCCOZXOD-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.18 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|