C46H86N2O6-2 — CID 18533682
2,2-bis(2,2,6,6-tetramethyl-1-nonoxypiperidin-4-yl)decanedioate (PubChem CID 18533682) has the molecular formula C46H86N2O6-2 and a molecular weight of 763.20 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethyl-1-nonoxypiperidin-4-yl)decanedioate.
| Compound Name | 2,2-bis(2,2,6,6-tetramethyl-1-nonoxypiperidin-4-yl)decanedioate |
|---|---|
| PubChem CID | 18533682 |
| Molecular Formula | C46H86N2O6-2 |
| Molecular Weight | 763.20 g/mol |
| Exact Mass | 762.65 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethyl-1-nonoxypiperidin-4-yl)decanedioate |
| SMILES | CCCCCCCCCON1C(C)(C)CC(C(CCCCCCCC(=O)[O-])(C(=O)[O-])C2CC(C)(C)N(OCCCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C46H88N2O6/c1-11-13-15-17-19-24-28-32-53-47-42(3,4)34-38(35-43(47,5)6)46(41(51)52,31-27-23-21-22-26-30-40(49)50)39-36-44(7,8)48(45(9,10)37-39)54-33-29-25-20-18-16-14-12-2/h38-39H,11-37H2,1-10H3,(H,49,50)(H,51,52)/p-2 |
| InChIKey | KAVFFNSAKKWADN-UHFFFAOYSA-L |
| XLogP | 10.11 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.20 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|