C40H58N2O6-2 — CID 22598269
2,2-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)decanedioate (PubChem CID 22598269) has the molecular formula C40H58N2O6-2 and a molecular weight of 662.91 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)decanedioate.
| Compound Name | 2,2-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)decanedioate |
|---|---|
| PubChem CID | 22598269 |
| Molecular Formula | C40H58N2O6-2 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethyl-1-phenoxypiperidin-4-yl)decanedioate |
| SMILES | CC1(C)CC(C(CCCCCCCC(=O)[O-])(C(=O)[O-])C2CC(C)(C)N(Oc3ccccc3)C(C)(C)C2)CC(C)(C)N1Oc1ccccc1 |
| InChI | InChI=1S/C40H60N2O6/c1-36(2)26-30(27-37(3,4)41(36)47-32-20-14-12-15-21-32)40(35(45)46,25-19-11-9-10-18-24-34(43)44)31-28-38(5,6)42(39(7,8)29-31)48-33-22-16-13-17-23-33/h12-17,20-23,30-31H,9-11,18-19,24-29H2,1-8H3,(H,43,44)(H,45,46)/p-2 |
| InChIKey | AHFCTGGLYRZUQD-UHFFFAOYSA-L |
| XLogP | 6.73 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|