C31H37NO3 — CID 11397293
(2,2,6,6-tetramethylpiperidin-1-yl) 6-hydroxy-8-phenyl-6-(2-phenylethynyl)oct-7-ynoate (PubChem CID 11397293) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-1-yl) 6-hydroxy-8-phenyl-6-(2-phenylethynyl)oct-7-ynoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-1-yl) 6-hydroxy-8-phenyl-6-(2-phenylethynyl)oct-7-ynoate |
|---|---|
| PubChem CID | 11397293 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-1-yl) 6-hydroxy-8-phenyl-6-(2-phenylethynyl)oct-7-ynoate |
| SMILES | CC1(C)CCCC(C)(C)N1OC(=O)CCCCC(O)(C#Cc1ccccc1)C#Cc1ccccc1 |
| InChI | InChI=1S/C31H37NO3/c1-29(2)21-13-22-30(3,4)32(29)35-28(33)18-11-12-23-31(34,24-19-26-14-7-5-8-15-26)25-20-27-16-9-6-10-17-27/h5-10,14-17,34H,11-13,18,21-23H2,1-4H3 |
| InChIKey | URIQFRTZVKCRPY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|