C18H23NO2 — CID 11066027
2-[[1-(3-phenylprop-2-ynyl)cyclohexyl]methylamino]acetic acid (PubChem CID 11066027) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[[1-(3-phenylprop-2-ynyl)cyclohexyl]methylamino]acetic acid.
| Compound Name | 2-[[1-(3-phenylprop-2-ynyl)cyclohexyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 11066027 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[[1-(3-phenylprop-2-ynyl)cyclohexyl]methylamino]acetic acid |
| SMILES | O=C(O)CNCC1(CC#Cc2ccccc2)CCCCC1 |
| InChI | InChI=1S/C18H23NO2/c20-17(21)14-19-15-18(11-5-2-6-12-18)13-7-10-16-8-3-1-4-9-16/h1,3-4,8-9,19H,2,5-6,11-15H2,(H,20,21) |
| InChIKey | VRPBOVLFOIMZPA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|