C24H24O2 — CID 11462069
2,2-dimethyl-5,5-bis(3-phenylprop-2-ynyl)-1,3-dioxane (PubChem CID 11462069) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is 2,2-dimethyl-5,5-bis(3-phenylprop-2-ynyl)-1,3-dioxane.
| Compound Name | 2,2-dimethyl-5,5-bis(3-phenylprop-2-ynyl)-1,3-dioxane |
|---|---|
| PubChem CID | 11462069 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2,2-dimethyl-5,5-bis(3-phenylprop-2-ynyl)-1,3-dioxane |
| SMILES | CC1(C)OCC(CC#Cc2ccccc2)(CC#Cc2ccccc2)CO1 |
| InChI | InChI=1S/C24H24O2/c1-23(2)25-19-24(20-26-23,17-9-15-21-11-5-3-6-12-21)18-10-16-22-13-7-4-8-14-22/h3-8,11-14H,17-20H2,1-2H3 |
| InChIKey | SVGWCOKGZMDMLA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|