C21H20N2 — CID 133188423
1,3-bis(3-phenylprop-2-ynyl)imidazolidine (PubChem CID 133188423) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1,3-bis(3-phenylprop-2-ynyl)imidazolidine.
| Compound Name | 1,3-bis(3-phenylprop-2-ynyl)imidazolidine |
|---|---|
| PubChem CID | 133188423 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1,3-bis(3-phenylprop-2-ynyl)imidazolidine |
| SMILES | C(#Cc1ccccc1)CN1CCN(CC#Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H20N2/c1-3-9-20(10-4-1)13-7-15-22-17-18-23(19-22)16-8-14-21-11-5-2-6-12-21/h1-6,9-12H,15-19H2 |
| InChIKey | HIURUSRTLOSJEC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|