C21H27NO4 — CID 102019988
13-(5-phenylpenta-2,4-diynyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane (PubChem CID 102019988) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 13-(5-phenylpenta-2,4-diynyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane.
| Compound Name | 13-(5-phenylpenta-2,4-diynyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
|---|---|
| PubChem CID | 102019988 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 13-(5-phenylpenta-2,4-diynyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
| SMILES | C(C#Cc1ccccc1)#CCN1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C21H27NO4/c1-3-7-21(8-4-1)9-5-2-6-10-22-11-13-23-15-17-25-19-20-26-18-16-24-14-12-22/h1,3-4,7-8H,10-20H2 |
| InChIKey | BXIBPGCPXSGSBM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|