C12H18N2O — CID 91621873
N,N-dimethyl-6-morpholin-4-ylhexa-2,4-diyn-1-amine (PubChem CID 91621873) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N,N-dimethyl-6-morpholin-4-ylhexa-2,4-diyn-1-amine.
| Compound Name | N,N-dimethyl-6-morpholin-4-ylhexa-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 91621873 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N,N-dimethyl-6-morpholin-4-ylhexa-2,4-diyn-1-amine |
| SMILES | CN(C)CC#CC#CCN1CCOCC1 |
| InChI | InChI=1S/C12H18N2O/c1-13(2)7-5-3-4-6-8-14-9-11-15-12-10-14/h7-12H2,1-2H3 |
| InChIKey | JJHOMVJLOFSZAF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|