C12H19NO2 — CID 2840553
2,3-dimethyl-6-morpholin-4-ylhex-1-en-4-yn-3-ol (PubChem CID 2840553) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2,3-dimethyl-6-morpholin-4-ylhex-1-en-4-yn-3-ol.
| Compound Name | 2,3-dimethyl-6-morpholin-4-ylhex-1-en-4-yn-3-ol |
|---|---|
| PubChem CID | 2840553 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2,3-dimethyl-6-morpholin-4-ylhex-1-en-4-yn-3-ol |
| SMILES | C=C(C)C(C)(O)C#CCN1CCOCC1 |
| InChI | InChI=1S/C12H19NO2/c1-11(2)12(3,14)5-4-6-13-7-9-15-10-8-13/h14H,1,6-10H2,2-3H3 |
| InChIKey | TWTSCHCGPAABMS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|