C28H40N2 — CID 3051281
1-(3-phenylprop-2-ynyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazine (PubChem CID 3051281) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 1-(3-phenylprop-2-ynyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazine.
| Compound Name | 1-(3-phenylprop-2-ynyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazine |
|---|---|
| PubChem CID | 3051281 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 1-(3-phenylprop-2-ynyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienyl)piperazine |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCN1CCN(CC#Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H40N2/c1-25(2)11-8-12-26(3)13-9-14-27(4)18-20-30-23-21-29(22-24-30)19-10-17-28-15-6-5-7-16-28/h5-7,11,13,15-16,18H,8-9,12,14,19-24H2,1-4H3 |
| InChIKey | WASWCSHWRZJCFW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|