C20H36N2 — CID 44514516
1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,4-diazepane (PubChem CID 44514516) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,4-diazepane.
| Compound Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,4-diazepane |
|---|---|
| PubChem CID | 44514516 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 1-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1,4-diazepane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CN1CCCNCC1 |
| InChI | InChI=1S/C20H36N2/c1-18(2)8-5-9-19(3)10-6-11-20(4)12-16-22-15-7-13-21-14-17-22/h8,10,12,21H,5-7,9,11,13-17H2,1-4H3/b19-10+,20-12+ |
| InChIKey | STLGXMYFZUWKFE-FIOGTWENSA-N |
| XLogP | 4.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|