C16H30N2 — CID 2059248
1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-ethylpiperazine (PubChem CID 2059248) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-ethylpiperazine.
| Compound Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 2059248 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(C/C=C(/C)CCC=C(C)C)CC1 |
| InChI | InChI=1S/C16H30N2/c1-5-17-11-13-18(14-12-17)10-9-16(4)8-6-7-15(2)3/h7,9H,5-6,8,10-14H2,1-4H3/b16-9- |
| InChIKey | DGBSESFNQVUNBE-SXGWCWSVSA-N |
| XLogP | 3.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|